EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | COC(=O)CCC(=O)CN |
| InChI | InChI=1S/C6H11NO3/c1-10-6(9)3-2-5(8)4-7/h2-4,7H2,1H3 |
| InChIKey | YUUAYBAIHCDHHD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 5-aminolevulinate (CHEBI:724125) has functional parent 5-aminolevulinic acid (CHEBI:17549) |
| methyl 5-aminolevulinate (CHEBI:724125) has role antineoplastic agent (CHEBI:35610) |
| methyl 5-aminolevulinate (CHEBI:724125) has role dermatologic drug (CHEBI:50177) |
| methyl 5-aminolevulinate (CHEBI:724125) has role photosensitizing agent (CHEBI:47868) |
| methyl 5-aminolevulinate (CHEBI:724125) has role prodrug (CHEBI:50266) |
| methyl 5-aminolevulinate (CHEBI:724125) is a δ-amino acid ester (CHEBI:60638) |
| Incoming Relation(s) |
| methyl 5-aminolevulinate hydrochloride (CHEBI:60641) has part methyl 5-aminolevulinate (CHEBI:724125) |
| IUPAC Name |
|---|
| methyl 5-amino-4-oxopentanoate |
| Synonyms | Source |
|---|---|
| 5-aminolevulinic acid methyl ester | ChemIDplus |
| aminolevulinic acid methyl ester | ChemIDplus |
| Methyl aminolevulinate | ChEMBL |
| methyl δ-aminolevulinate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 168 | DrugCentral |
| D08204 | KEGG DRUG |
| DB00992 | DrugBank |
| Methyl_Aminolevulinate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5921212 | Reaxys |
| CAS:33320-16-0 | ChemIDplus |
| CAS:33320-16-0 | KEGG DRUG |
| Citations |
|---|