EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17534 - 6-amino-2-oxohexanoic acid
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | NCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C6H11NO3/c7-4-2-1-3-5(8)6(9)10/h1-4,7H2,(H,9,10) |
| InChIKey | GWENQMVPLJAMAE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-amino-2-oxohexanoic acid (CHEBI:17534) has functional parent hexanoic acid (CHEBI:30776) |
| 6-amino-2-oxohexanoic acid (CHEBI:17534) has role human metabolite (CHEBI:77746) |
| 6-amino-2-oxohexanoic acid (CHEBI:17534) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 6-amino-2-oxohexanoic acid (CHEBI:17534) is a ε-amino acid (CHEBI:35958) |
| 6-amino-2-oxohexanoic acid (CHEBI:17534) is tautomer of 6-amino-2-oxohexanoic acid zwitterion (CHEBI:58183) |
| Incoming Relation(s) |
| 6-acetamido-2-oxohexanoic acid (CHEBI:28376) has functional parent 6-amino-2-oxohexanoic acid (CHEBI:17534) |
| 6-amino-2-oxohexanoic acid zwitterion (CHEBI:58183) is tautomer of 6-amino-2-oxohexanoic acid (CHEBI:17534) |
| IUPAC Name |
|---|
| 6-amino-2-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 6-Amino-2-oxohexanoate | KEGG COMPOUND |
| 2-Oxo-6-aminocaproate | KEGG COMPOUND |
| 2-oxo-6-aminocaproate | ChEBI |