EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H13NO4 |
| Net Charge | 0 |
| Average Mass | 187.195 |
| Monoisotopic Mass | 187.08446 |
| SMILES | CC(=O)NCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C8H13NO4/c1-6(10)9-5-3-2-4-7(11)8(12)13/h2-5H2,1H3,(H,9,10)(H,12,13) |
| InChIKey | NGCXIFFZXAZRAF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-acetamido-2-oxohexanoic acid (CHEBI:28376) has functional parent 6-amino-2-oxohexanoic acid (CHEBI:17534) |
| 6-acetamido-2-oxohexanoic acid (CHEBI:28376) has role metabolite (CHEBI:25212) |
| 6-acetamido-2-oxohexanoic acid (CHEBI:28376) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 6-acetamido-2-oxohexanoic acid (CHEBI:28376) is a acetamides (CHEBI:22160) |
| 6-acetamido-2-oxohexanoic acid (CHEBI:28376) is conjugate acid of 6-acetamido-2-oxohexanoate (CHEBI:79192) |
| Incoming Relation(s) |
| 6-acetamido-2-oxohexanoate (CHEBI:79192) is conjugate base of 6-acetamido-2-oxohexanoic acid (CHEBI:28376) |
| IUPAC Name |
|---|
| 6-(acetylamino)-2-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 2-Keto-6-acetamidohexanoic acid | HMDB |
| 2-Keto-6-acetamidocaproic acid | HMDB |
| 2-Oxo-6-acetamidocaproic acid | HMDB |
| 6-Acetamido-2-oxohexanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C05548 | KEGG COMPOUND |
| HMDB0012150 | HMDB |
| 2-KETO-6-ACETAMIDOCAPROATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:59403-50-8 | ChemIDplus |