EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | [NH3+]CCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H11NO3/c7-4-2-1-3-5(8)6(9)10/h1-4,7H2,(H,9,10) |
| InChIKey | GWENQMVPLJAMAE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-amino-2-oxohexanoic acid zwitterion (CHEBI:58183) is a amino-acid zwitterion (CHEBI:35238) |
| 6-amino-2-oxohexanoic acid zwitterion (CHEBI:58183) is tautomer of 6-amino-2-oxohexanoic acid (CHEBI:17534) |
| Incoming Relation(s) |
| 6-amino-2-oxohexanoic acid (CHEBI:17534) is tautomer of 6-amino-2-oxohexanoic acid zwitterion (CHEBI:58183) |
| IUPAC Name |
|---|
| 6-azaniumyl-2-oxohexanoate |
| Synonym | Source |
|---|---|
| 6-ammonio-2-oxohexanoate | IUPAC |
| UniProt Name | Source |
|---|---|
| 6-amino-2-oxohexanoate | UniProt |