EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O7 |
| Net Charge | 0 |
| Average Mass | 202.118 |
| Monoisotopic Mass | 202.01135 |
| SMILES | O=C(O)/C=C(\C=C(\O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h1-2,8H,(H,9,10)(H,11,12)(H,13,14)/b3-2+,4-1+ |
| InChIKey | QWLUKZXOQAQUFQ-DXLKSGPOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconic acid (CHEBI:17424) is a 4-carboxy-2-hydroxyhexa-2,4-dienedioic acid (CHEBI:16321) |
| 4-carboxy-2-hydroxy-cis,cis-muconic acid (CHEBI:17424) is conjugate acid of 4-carboxy-2-hydroxy-cis,cis-muconate(3−) (CHEBI:58142) |
| Incoming Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconate(3−) (CHEBI:58142) is conjugate base of 4-carboxy-2-hydroxy-cis,cis-muconic acid (CHEBI:17424) |
| IUPAC Name |
|---|
| (1E,3E)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 4-carboxy-2-hydroxy-cis,cis-muconate | ChEBI |
| 4-Carboxy-2-hydroxy-cis,cis-muconate | KEGG COMPOUND |
| 4-Carboxy-2-hydroxyhexa-2,4-cis,cis-dienedioate | KEGG COMPOUND |