EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3O7 |
| Net Charge | -3 |
| Average Mass | 199.094 |
| Monoisotopic Mass | 198.98952 |
| SMILES | O=C([O-])/C=C(\C=C(\O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H6O7/c8-4(7(13)14)1-3(6(11)12)2-5(9)10/h1-2,8H,(H,9,10)(H,11,12)(H,13,14)/p-3/b3-2+,4-1+ |
| InChIKey | QWLUKZXOQAQUFQ-DXLKSGPOSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconate(3−) (CHEBI:58142) is a tricarboxylic acid trianion (CHEBI:27092) |
| 4-carboxy-2-hydroxy-cis,cis-muconate(3−) (CHEBI:58142) is conjugate base of 4-carboxy-2-hydroxy-cis,cis-muconic acid (CHEBI:17424) |
| Incoming Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconic acid (CHEBI:17424) is conjugate acid of 4-carboxy-2-hydroxy-cis,cis-muconate(3−) (CHEBI:58142) |
| IUPAC Name |
|---|
| (1E,3E)-4-hydroxybuta-1,3-diene-1,2,4-tricarboxylate |
| Synonyms | Source |
|---|---|
| 4-carboxy-2-hydroxy-cis,cis-muconate | ChEBI |
| 4-carboxy-2-hydroxy-cis,cis-muconate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-carboxy-2-hydroxy-cis,cis-muconate | UniProt |