EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25O7P2 |
| Net Charge | -3 |
| Average Mass | 379.306 |
| Monoisotopic Mass | 379.10920 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/p-3/b14-9+,15-11+ |
| InChIKey | VWFJDQUYCIWHTN-YFVJMOTDSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) has role human metabolite (CHEBI:77746) |
| 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) is a organophosphate oxoanion (CHEBI:58945) |
| 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) is conjugate base of 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) |
| Incoming Relation(s) |
| 2-trans,6-trans-farnesyl diphosphate (CHEBI:17407) is conjugate acid of 2-trans,6-trans-farnesyl diphosphate(3−) (CHEBI:175763) |
| IUPAC Name |
|---|
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl diphosphate |
| Synonyms | Source |
|---|---|
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl (phosphonatooxy)phosphonate | ChEBI |
| (2E,6E)-farnesyl diphosphate(3−) | ChEBI |
| (2-trans,6-trans)-farnesyl diphosphate(3−) | ChEBI |
| farnesyl pyrophosphate(3−) | ChEBI |
| (E,E)-farnesyl diphosphate(3−) | ChEBI |
| trans,trans-farnesyl diphosphate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E,6E)-farnesyl diphosphate | UniProt |