EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16F2N3O5 |
| Net Charge | -1 |
| Average Mass | 404.349 |
| Monoisotopic Mass | 404.10635 |
| SMILES | [H][C@@]12Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c([O-])c3C(=O)N1[C@@H](C)CO2 |
| InChI | InChI=1S/C19H17F2N3O5/c1-9-8-29-14-7-23-6-12(16(25)17(26)15(23)19(28)24(9)14)18(27)22-5-10-2-3-11(20)4-13(10)21/h2-4,6,9,14,26H,5,7-8H2,1H3,(H,22,27)/p-1/t9-,14+/m0/s1 |
| InChIKey | WCWSTNLSLKSJPK-LKFCYVNXSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabotegravir(1−) (CHEBI:172947) is a organic anion (CHEBI:25696) |
| cabotegravir(1−) (CHEBI:172947) is conjugate base of cabotegravir (CHEBI:172944) |
| Incoming Relation(s) |
| cabotegravir sodium (CHEBI:172948) has part cabotegravir(1−) (CHEBI:172947) |
| cabotegravir (CHEBI:172944) is conjugate acid of cabotegravir(1−) (CHEBI:172947) |
| IUPAC Name |
|---|
| (3S,11aR)-8-[(2,4-difluorobenzyl)carbamoyl]-3-methyl-5,7-dioxo-2,3,5,7,11,11a-hexahydro[1,3]oxazolo[3,2-a]pyrido[1,2-d]pyrazin-6-olate |
| Synonym | Source |
|---|---|
| cabotegravir anion | ChEBI |