EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16F2N3O5.Na |
| Net Charge | 0 |
| Average Mass | 427.339 |
| Monoisotopic Mass | 427.09557 |
| SMILES | [H][C@@]12Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c([O-])c3C(=O)N1[C@@H](C)CO2.[Na+] |
| InChI | InChI=1S/C19H17F2N3O5.Na/c1-9-8-29-14-7-23-6-12(16(25)17(26)15(23)19(28)24(9)14)18(27)22-5-10-2-3-11(20)4-13(10)21;/h2-4,6,9,14,26H,5,7-8H2,1H3,(H,22,27);/q;+1/p-1/t9-,14+;/m0./s1 |
| InChIKey | AEZBWGMXBKPGFP-KIUAEZIZSA-M |
| Roles Classification |
|---|
| Biological Role: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabotegravir sodium (CHEBI:172948) has part cabotegravir(1−) (CHEBI:172947) |
| cabotegravir sodium (CHEBI:172948) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| cabotegravir sodium (CHEBI:172948) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (3S,11aR)-8-[(2,4-difluorobenzyl)carbamoyl]-3-methyl-5,7-dioxo-2,3,5,7,11,11a-hexahydro[1,3]oxazolo[3,2-a]pyrido[1,2-d]pyrazin-6-olate |
| Synonyms | Source |
|---|---|
| GSK1265744B | ChemIDplus |
| GSK 1265744B | ChEBI |
| S 265744B | ChemIDplus |
| GSK-1265744B | ChemIDplus |
| S-265744B | ChemIDplus |
| Brand Name | Source |
|---|---|
| Vocabria | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10549 | KEGG DRUG |
| DBSALT002064 | DrugBank |
| 32702138 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1051375-13-3 | ChemIDplus |
| Citations |
|---|