EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17F2N3O5 |
| Net Charge | 0 |
| Average Mass | 405.357 |
| Monoisotopic Mass | 405.11363 |
| SMILES | [H][C@@]12Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c(O)c3C(=O)N1[C@@H](C)CO2 |
| InChI | InChI=1S/C19H17F2N3O5/c1-9-8-29-14-7-23-6-12(16(25)17(26)15(23)19(28)24(9)14)18(27)22-5-10-2-3-11(20)4-13(10)21/h2-4,6,9,14,26H,5,7-8H2,1H3,(H,22,27)/t9-,14+/m0/s1 |
| InChIKey | WCWSTNLSLKSJPK-LKFCYVNXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabotegravir (CHEBI:172944) has role antiviral agent (CHEBI:22587) |
| cabotegravir (CHEBI:172944) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| cabotegravir (CHEBI:172944) is a difluorobenzene (CHEBI:38582) |
| cabotegravir (CHEBI:172944) is a monocarboxylic acid amide (CHEBI:29347) |
| cabotegravir (CHEBI:172944) is a organic heterotricyclic compound (CHEBI:26979) |
| cabotegravir (CHEBI:172944) is a secondary carboxamide (CHEBI:140325) |
| cabotegravir (CHEBI:172944) is conjugate acid of cabotegravir(1−) (CHEBI:172947) |
| Incoming Relation(s) |
| cabotegravir(1−) (CHEBI:172947) is conjugate base of cabotegravir (CHEBI:172944) |
| IUPAC Name |
|---|
| (3S,11aR)-N-(2,4-difluorobenzyl)-6-hydroxy-3-methyl-5,7-dioxo-2,3,5,7,11,11a-hexahydro[1,3]oxazolo[3,2-a]pyrido[1,2-d]pyrazine-8-carboxamide |
| INNs | Source |
|---|---|
| cabotegravir | WHO MedNet |
| cabotegravir | WHO MedNet |
| cabotégravir | WHO MedNet |
| cabotegravirum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CAB | ChemIDplus |
| GSK 1265744 | ChemIDplus |
| GSK-1265744 | ChemIDplus |
| GSK1265744 | ChEBI |
| GSK-1265744A | DrugBank |
| GSK1265744A | ChemIDplus |
| Brand Names | Source |
|---|---|
| Apretude | ChEMBL |
| Cabotegravir component of cabenuva | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 30829503 | ChemSpider |
| Cabotegravir | Wikipedia |
| D10548 | KEGG DRUG |
| DB11751 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1051375-10-0 | ChemIDplus |
| Citations |
|---|