EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10NO3 |
| Net Charge | -1 |
| Average Mass | 204.205 |
| Monoisotopic Mass | 204.06662 |
| SMILES | O=C([O-])C(O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15)/p-1 |
| InChIKey | XGILAAMKEQUXLS-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (2361979) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(indol-3-yl)lactate (CHEBI:17282) has functional parent lactate (CHEBI:24996) |
| 3-(indol-3-yl)lactate (CHEBI:17282) has role human metabolite (CHEBI:77746) |
| 3-(indol-3-yl)lactate (CHEBI:17282) is a 2-hydroxy carboxylate (CHEBI:58896) |
| 3-(indol-3-yl)lactate (CHEBI:17282) is conjugate base of 3-(indol-3-yl)lactic acid (CHEBI:24813) |
| Incoming Relation(s) |
| 3-(indol-3-yl)lactic acid (CHEBI:24813) is conjugate acid of 3-(indol-3-yl)lactate (CHEBI:17282) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(1H-indol-3-yl)propanoate |
| Synonyms | Source |
|---|---|
| Indolelactate | KEGG COMPOUND |
| indole-3-lactate | ChEBI |
| indole lactate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-(indol-3-yl)lactate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02043 | KEGG COMPOUND |