EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO3 |
| Net Charge | 0 |
| Average Mass | 205.213 |
| Monoisotopic Mass | 205.07389 |
| SMILES | O=C(O)C(O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15) |
| InChIKey | XGILAAMKEQUXLS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (2361979) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(indol-3-yl)lactic acid (CHEBI:24813) has functional parent rac-lactic acid (CHEBI:28358) |
| 3-(indol-3-yl)lactic acid (CHEBI:24813) has role human metabolite (CHEBI:77746) |
| 3-(indol-3-yl)lactic acid (CHEBI:24813) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 3-(indol-3-yl)lactic acid (CHEBI:24813) is a indol-3-yl carboxylic acid (CHEBI:24810) |
| 3-(indol-3-yl)lactic acid (CHEBI:24813) is conjugate acid of 3-(indol-3-yl)lactate (CHEBI:17282) |
| Incoming Relation(s) |
| 3-(indol-3-yl)lactate (CHEBI:17282) is conjugate base of 3-(indol-3-yl)lactic acid (CHEBI:24813) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(1H-indol-3-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| 3-(Indol-3-yl)lactic acid | ChemIDplus |
| alpha-Hydroxy-1H-indole-3-propanoic acid | ChemIDplus |
| indole-3-lactic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C02043 | KEGG COMPOUND |
| HMDB0000671 | HMDB |
| INDOLE_LACTATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:86202 | Reaxys |
| CAS:1821-52-9 | ChemIDplus |
| CAS:1821-52-9 | KEGG COMPOUND |
| Citations |
|---|