EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O4 |
| Net Charge | -2 |
| Average Mass | 156.137 |
| Monoisotopic Mass | 156.04336 |
| SMILES | CC(C)/C(=C/C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H10O4/c1-4(2)5(7(10)11)3-6(8)9/h3-4H,1-2H3,(H,8,9)(H,10,11)/p-2/b5-3- |
| InChIKey | NJMGRJLQRLFQQX-HYXAFXHYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-isopropylmaleate(2−) (CHEBI:58085) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-isopropylmaleate(2−) (CHEBI:58085) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-isopropylmaleate(2−) (CHEBI:58085) is conjugate base of 2-isopropylmaleic acid (CHEBI:17275) |
| Incoming Relation(s) |
| 2-isopropylmaleic acid (CHEBI:17275) is conjugate acid of 2-isopropylmaleate(2−) (CHEBI:58085) |
| IUPAC Name |
|---|
| (2L)-2-isopropylbut-2-enedioate |
| Synonyms | Source |
|---|---|
| 2-isopropylmaleate | ChEBI |
| 2-isopropylmaleate dianion | ChEBI |
| (2Z)-2-(propan-2-yl)but-2-enedioate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-isopropylmaleate | UniProt |