EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2S |
| Net Charge | 0 |
| Average Mass | 135.188 |
| Monoisotopic Mass | 135.03540 |
| SMILES | [NH3+]C(CCS)C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7) |
| InChIKey | FFFHZYDWPBMWHY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17024318) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homocysteine zwitterion (CHEBI:58065) has role Escherichia coli metabolite (CHEBI:76971) |
| homocysteine zwitterion (CHEBI:58065) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| homocysteine zwitterion (CHEBI:58065) has role human metabolite (CHEBI:77746) |
| homocysteine zwitterion (CHEBI:58065) is a amino-acid zwitterion (CHEBI:35238) |
| homocysteine zwitterion (CHEBI:58065) is tautomer of homocysteine (CHEBI:17230) |
| Incoming Relation(s) |
| homocysteine (CHEBI:17230) is tautomer of homocysteine zwitterion (CHEBI:58065) |
| IUPAC Name |
|---|
| 2-azaniumyl-4-sulfanylbutanoate |
| Synonym | Source |
|---|---|
| 2-ammonio-4-sulfanylbutanoate | ChEBI |