EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O3 |
| Net Charge | 0 |
| Average Mass | 176.171 |
| Monoisotopic Mass | 176.04734 |
| SMILES | Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C10H8O3/c1-6-4-10(12)13-9-5-7(11)2-3-8(6)9/h2-5,11H,1H3 |
| InChIKey | HSHNITRMYYLLCV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hyaluronic acid synthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of hyaluronic acid. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylumbelliferone (CHEBI:17224) has functional parent umbelliferone (CHEBI:27510) |
| 4-methylumbelliferone (CHEBI:17224) has role antineoplastic agent (CHEBI:35610) |
| 4-methylumbelliferone (CHEBI:17224) has role hyaluronic acid synthesis inhibitor (CHEBI:131561) |
| 4-methylumbelliferone (CHEBI:17224) is a hydroxycoumarin (CHEBI:37912) |
| Incoming Relation(s) |
| 4-methylumbelliferone sulfate (CHEBI:1905) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferyl butyate (CHEBI:91120) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferyl α-D-galactoside (CHEBI:91115) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferyl α-L-arabinoside (CHEBI:90130) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferyl β-D-galactoside (CHEBI:91116) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferyl β-D-glucoside (CHEBI:91117) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| chlorferron (CHEBI:38620) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| IUPAC Name |
|---|
| 7-hydroxy-4-methyl-2H-chromen-2-one |
| INNs | Source |
|---|---|
| himecromona | ChemIDplus |
| hymecromonum | ChemIDplus |
| hymecromone | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 4-Methylumbelliferone | KEGG COMPOUND |
| Hymecromone | KEGG COMPOUND |
| 4-Methyl-7-hydroxycoumarin | ChemIDplus |
| 7-Hydroxy-4-methyl-2-oxo-2H-1-benzopyran | ChemIDplus |
| 7-Hydroxy-4-methylcoumarin | ChemIDplus |
| beta-Methylumbelliferone | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 4-methylumbelliferone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C03081 | KEGG COMPOUND |
| D00170 | KEGG DRUG |
| CPD-182 | MetaCyc |
| HMDB0059622 | HMDB |
| Hymecromone | Wikipedia |
| 4MU | PDBeChem |
| LSM-3025 | LINCS |
| 1401 | DrugCentral |
| Citations |
|---|