EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:1904 - 4-methylumbelliferone β-D-glucuronide
| Formula | C16H16O9 |
| Net Charge | 0 |
| Average Mass | 352.295 |
| Monoisotopic Mass | 352.07943 |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C16H16O9/c1-6-4-10(17)24-9-5-7(2-3-8(6)9)23-16-13(20)11(18)12(19)14(25-16)15(21)22/h2-5,11-14,16,18-20H,1H3,(H,21,22)/t11-,12-,13+,14-,16+/m0/s1 |
| InChIKey | ARQXEQLMMNGFDU-JHZZJYKESA-N |
| Roles Classification |
|---|
| Biological Role: | hyaluronan synthesis inhibitor Any inhibitor that interferes with the synthesis of hyaluronic acid (HA, also known as hyaluronan). |
| Applications: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) has role antineoplastic agent (CHEBI:35610) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) has role chromogenic compound (CHEBI:75050) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) has role hyaluronan synthesis inhibitor (CHEBI:145253) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) is a coumarins (CHEBI:23403) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) is a monosaccharide derivative (CHEBI:63367) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) is a β-D-glucosiduronic acid (CHEBI:15341) |
| 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) is conjugate acid of 4-methylumbelliferone β-D-glucuronide(1−) (CHEBI:144582) |
| Incoming Relation(s) |
| 4-methylumbelliferone β-D-glucuronide(1−) (CHEBI:144582) is conjugate base of 4-methylumbelliferone β-D-glucuronide (CHEBI:1904) |
| IUPAC Name |
|---|
| 4-methyl-2-oxo-2H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 4-Methylumbelliferone glucuronide | KEGG COMPOUND |
| 4-Methylumbelliferyl beta-glucuronide | ChemIDplus |
| 4-Methylumbelliferyl glucuronide | KEGG COMPOUND |
| 4-Methylumbelliferyl glucuronide | ChemIDplus |
| 4-MUG | ChEBI |
| Citations |
|---|