EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O4 |
| Net Charge | 0 |
| Average Mass | 246.262 |
| Monoisotopic Mass | 246.08921 |
| SMILES | CCCC(=O)Oc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C14H14O4/c1-3-4-13(15)17-10-5-6-11-9(2)7-14(16)18-12(11)8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | WKPUJZVCZXWKCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromogenic compound Colourless, endogenous or exogenous pigment precursors that may be transformed by biological mechanisms into coloured compounds. They are used in biochemical assays and in diagnosis as indicators, particularly in the form of enzyme substrates. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylumbelliferyl butyate (CHEBI:91120) has functional parent 4-methylumbelliferone (CHEBI:17224) |
| 4-methylumbelliferyl butyate (CHEBI:91120) has role chromogenic compound (CHEBI:75050) |
| 4-methylumbelliferyl butyate (CHEBI:91120) is a butyrate ester (CHEBI:50477) |
| 4-methylumbelliferyl butyate (CHEBI:91120) is a coumarins (CHEBI:23403) |
| IUPAC Name |
|---|
| 4-methyl-2-oxo-2H-1-benzopyran-7-yl butanoate |
| Synonyms | Source |
|---|---|
| 4-Methyl-2-oxo-2H-1-benzopyran-7-yl butyrate | ChemIDplus |
| 4-Methylcoumarin-7-yl butyrate | ChemIDplus |
| 4-Methylumbelliferone butyrate | ChemIDplus |
| 4-methylumbelliferyl butanoate | ChEBI |
| 7-(propylcarbonyl)oxy-4-methyl-2H-1-benzopyran-2-one | ChEBI |
| Butanoic acid, 4-methyl-2-oxo-2H-1-benzopyran-7-yl ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:227973 | Reaxys |
| CAS:17695-46-4 | ChemIDplus |
| Citations |
|---|