EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17O7P2 |
| Net Charge | -3 |
| Average Mass | 311.187 |
| Monoisotopic Mass | 311.04660 |
| SMILES | CC(C)=CCC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)5-4-6-10(3)7-8-16-19(14,15)17-18(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/p-3/b10-7+ |
| InChIKey | GVVPGTZRZFNKDS-JXMROGBWSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| geranyl diphosphate(3−) (CHEBI:58057) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| geranyl diphosphate(3−) (CHEBI:58057) has role human metabolite (CHEBI:77746) |
| geranyl diphosphate(3−) (CHEBI:58057) is a organophosphate oxoanion (CHEBI:58945) |
| geranyl diphosphate(3−) (CHEBI:58057) is conjugate base of geranyl diphosphate (CHEBI:17211) |
| Incoming Relation(s) |
| geranyl diphosphate (CHEBI:17211) is conjugate acid of geranyl diphosphate(3−) (CHEBI:58057) |
| IUPAC Name |
|---|
| (2E)-3,7-dimethylocta-2,6-dien-1-yl diphosphate |
| Synonyms | Source |
|---|---|
| geranyl diphosphate | ChEBI |
| geranyl pyrophosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E)-geranyl diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4549979 | Beilstein |