EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3 |
| Net Charge | 0 |
| Average Mass | 132.119 |
| Monoisotopic Mass | 132.05349 |
| SMILES | NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C4H8N2O3/c5-1-3(7)6-2-4(8)9/h1-2,5H2,(H,6,7)(H,8,9) |
| InChIKey | YMAWOPBAYDPSLA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycylglycine (CHEBI:17201) has functional parent glycine (CHEBI:15428) |
| glycylglycine (CHEBI:17201) has role human metabolite (CHEBI:77746) |
| glycylglycine (CHEBI:17201) is a dipeptide (CHEBI:46761) |
| glycylglycine (CHEBI:17201) is tautomer of glycylglycine zwitterion (CHEBI:356445) |
| Incoming Relation(s) |
| glycylglycine zwitterion (CHEBI:356445) is tautomer of glycylglycine (CHEBI:17201) |
| IUPAC Name |
|---|
| glycylglycine |
| Synonyms | Source |
|---|---|
| Glycylglycine | KEGG COMPOUND |
| Gly-Gly | JCBN |
| N-glycylglycine | NIST Chemistry WebBook |
| glycine dipeptide | NIST Chemistry WebBook |
| [(aminoacetyl)amino]acetic acid | NIST Chemistry WebBook |
| Gly2 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02037 | KEGG COMPOUND |
| GLYCYLGLYCINE | MetaCyc |
| HMDB0011733 | HMDB |
| Glycylglycine | Wikipedia |
| Citations |
|---|