EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8N2O3 |
| Net Charge | 0 |
| Average Mass | 132.119 |
| Monoisotopic Mass | 132.05349 |
| SMILES | [NH3+]CC(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C4H8N2O3/c5-1-3(7)6-2-4(8)9/h1-2,5H2,(H,6,7)(H,8,9) |
| InChIKey | YMAWOPBAYDPSLA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycylglycine zwitterion (CHEBI:356445) has role human metabolite (CHEBI:77746) |
| glycylglycine zwitterion (CHEBI:356445) is a dipeptide zwitterion (CHEBI:90799) |
| glycylglycine zwitterion (CHEBI:356445) is tautomer of glycylglycine (CHEBI:17201) |
| Incoming Relation(s) |
| glycylglycine (CHEBI:17201) is tautomer of glycylglycine zwitterion (CHEBI:356445) |
| IUPAC Name |
|---|
| [(azaniumylacetyl)amino]acetate |
| Synonym | Source |
|---|---|
| [(ammonioacetyl)amino]acetate | ChEMBL |
| UniProt Name | Source |
|---|---|
| glycylglycine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| GLYCYLGLYCINE | MetaCyc |
| Citations |
|---|