EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O8 |
| Net Charge | 0 |
| Average Mass | 448.512 |
| Monoisotopic Mass | 448.20972 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@H](O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]21[H] |
| InChI | InChI=1S/C24H32O8/c1-24-9-8-14-13-5-3-12(25)10-11(13)2-4-15(14)16(24)6-7-17(24)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-21,23,25-28H,2,4,6-9H2,1H3,(H,29,30)/t14-,15-,16+,17-,18+,19+,20-,21+,23-,24+/m1/s1 |
| InChIKey | MTKNDAQYHASLID-FNUZHIFDSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) has functional parent 17α-estradiol (CHEBI:17160) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) is a 3-hydroxy steroid (CHEBI:36834) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) is a phenols (CHEBI:33853) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) is a steroid glucosiduronic acid (CHEBI:26763) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) is a β-D-glucosiduronic acid (CHEBI:15341) |
| 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) is conjugate acid of 17α-estradiol 17-O-(β-D-glucuronide)(1−) (CHEBI:136642) |
| Incoming Relation(s) |
| 17α-estradiol 17-O-(β-D-glucuronide)(1−) (CHEBI:136642) is conjugate base of 17α-estradiol 17-O-(β-D-glucuronide) (CHEBI:137490) |
| IUPAC Name |
|---|
| 3-hydroxyestra-1,3,5(10)-trien-17α-yl β-D-glucopyranosiduronic acid |
| Citations |
|---|