EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 123.539 |
| Monoisotopic Mass | 123.00871 |
| SMILES | N[C@H](CCl)C(=O)O |
| InChI | InChI=1S/C3H6ClNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | ASBJGPTTYPEMLP-UWTATZPHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of serine palmitoyltransferase (EC 2.3.1.50). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-D-alanine (CHEBI:17092) has role EC 2.3.1.50 (serine C-palmitoyltransferase) inhibitor (CHEBI:59647) |
| 3-chloro-D-alanine (CHEBI:17092) is a D-alanine derivative (CHEBI:83944) |
| 3-chloro-D-alanine (CHEBI:17092) is a 3-chloroalanine (CHEBI:88164) |
| 3-chloro-D-alanine (CHEBI:17092) is enantiomer of 3-chloro-L-alanine (CHEBI:17403) |
| 3-chloro-D-alanine (CHEBI:17092) is tautomer of 3-chloro-D-alanine zwitterion (CHEBI:47291) |
| Incoming Relation(s) |
| 3-chloro-L-alanine (CHEBI:17403) is enantiomer of 3-chloro-D-alanine (CHEBI:17092) |
| 3-chloro-D-alanine zwitterion (CHEBI:47291) is tautomer of 3-chloro-D-alanine (CHEBI:17092) |
| IUPAC Name |
|---|
| 3-chloro-D-alanine |
| Synonyms | Source |
|---|---|
| 3-chloro-D-alanine | ChEBI |
| 3-Chloro-D-alanine | KEGG COMPOUND |