EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 123.539 |
| Monoisotopic Mass | 123.00871 |
| SMILES | [NH3+][C@H](CCl)C(=O)[O-] |
| InChI | InChI=1S/C3H6ClNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7)/t2-/m1/s1 |
| InChIKey | ASBJGPTTYPEMLP-UWTATZPHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloro-D-alanine zwitterion (CHEBI:47291) is a amino-acid zwitterion (CHEBI:35238) |
| 3-chloro-D-alanine zwitterion (CHEBI:47291) is a organochlorine compound (CHEBI:36683) |
| 3-chloro-D-alanine zwitterion (CHEBI:47291) is tautomer of 3-chloro-D-alanine (CHEBI:17092) |
| Incoming Relation(s) |
| 3-chloro-D-alanine (CHEBI:17092) is tautomer of 3-chloro-D-alanine zwitterion (CHEBI:47291) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-chloropropanoate |
| UniProt Name | Source |
|---|---|
| 3-chloro-D-alanine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C2N | PDBeChem |