EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 123.539 |
| Monoisotopic Mass | 123.00871 |
| SMILES | NC(CCl)C(=O)O |
| InChI | InChI=1S/C3H6ClNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7) |
| InChIKey | ASBJGPTTYPEMLP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-chloroalanine (CHEBI:88164) is a chloroalanine (CHEBI:23127) |
| 3-chloroalanine (CHEBI:88164) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 3-chloroalanine (CHEBI:88164) is a organochlorine compound (CHEBI:36683) |
| Incoming Relation(s) |
| 3-chloro-D-alanine (CHEBI:17092) is a 3-chloroalanine (CHEBI:88164) |
| 3-chloro-L-alanine (CHEBI:17403) is a 3-chloroalanine (CHEBI:88164) |
| IUPAC Name |
|---|
| 3-chloroalanine |
| Synonyms | Source |
|---|---|
| β-chloro-DL-alanine | SUBMITTER |
| 3-Chloro-DL-alanine | ChemIDplus |
| beta-Chloroalanine | ChemIDplus |
| DL-3-Chloroalanine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3-CHLORO-DL-ALANINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1721410 | Reaxys |
| CAS:3981-36-0 | ChemIDplus |