EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42N7O12 |
| Net Charge | +3 |
| Average Mass | 584.604 |
| Monoisotopic Mass | 584.28750 |
| SMILES | C[NH2+][C@@H]1[C@H](O[C@H]2[C@H](O[C@H]3[C@H](O)[C@@H](O)[C@H](NC(N)=[NH2+])[C@@H](O)[C@@H]3NC(N)=[NH2+])O[C@@H](C)[C@]2(O)C=O)O[C@@H](CO)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/p+3/t5-,6-,7+,8-,9-,10-,11+,12-,13-,14+,15+,16-,17-,18-,21+/m0/s1 |
| InChIKey | UCSJYZPVAKXKNQ-HZYVHMACSA-Q |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptomycin(3+) (CHEBI:58007) is a guanidinium ion (CHEBI:60251) |
| streptomycin(3+) (CHEBI:58007) is conjugate acid of streptomycin (CHEBI:17076) |
| Incoming Relation(s) |
| streptomycin (CHEBI:17076) is conjugate base of streptomycin(3+) (CHEBI:58007) |
| IUPAC Name |
|---|
| (1R,2R,3S,4R,5R,6S)-2,4-bis{[amino(iminio)methyl]amino}-3,5,6-trihydroxycyclohexyl 5-deoxy-2-O-[2-deoxy-2-(methylammonio)-α-L-glucopyranosyl]-3-C-formyl-α-L-lyxofuranoside |
| Synonym | Source |
|---|---|
| streptomycin trication | ChEBI |
| UniProt Name | Source |
|---|---|
| streptomycin | UniProt |