EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46N2O10 |
| Net Charge | +2 |
| Average Mass | 606.713 |
| Monoisotopic Mass | 606.31415 |
| SMILES | COc1cc(C(=O)OCCC[NH+]2CCC[NH+](CCCOC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C31H44N2O10/c1-36-24-18-22(19-25(37-2)28(24)40-5)30(34)42-16-8-12-32-10-7-11-33(15-14-32)13-9-17-43-31(35)23-20-26(38-3)29(41-6)27(21-23)39-4/h18-21H,7-17H2,1-6H3/p+2 |
| InChIKey | QVZCXCJXTMIDME-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dilazep(2+) (CHEBI:170000) is a tertiary ammonium ion (CHEBI:137982) |
| dilazep(2+) (CHEBI:170000) is conjugate acid of dilazep (CHEBI:92842) |
| Incoming Relation(s) |
| dilazep dihydrochloride (CHEBI:31493) has part dilazep(2+) (CHEBI:170000) |
| dilazep (CHEBI:92842) is conjugate base of dilazep(2+) (CHEBI:170000) |
| IUPAC Name |
|---|
| 1,4-bis{3-[(3,4,5-trimethoxybenzoyl)oxy]propyl}-1,4-diazepanediium |
| Synonyms | Source |
|---|---|
| 1,4-bis{3-[(3,4,5-trimethoxybenzoyl)oxy]propyl}-1,4-diazepane-1,4-diium | IUPAC |
| dilazep dication | ChEBI |