EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44N2O10.2HCl |
| Net Charge | 0 |
| Average Mass | 677.619 |
| Monoisotopic Mass | 676.25295 |
| SMILES | COc1cc(C(=O)OCCCN2CCCN(CCCOC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C31H44N2O10.2ClH/c1-36-24-18-22(19-25(37-2)28(24)40-5)30(34)42-16-8-12-32-10-7-11-33(15-14-32)13-9-17-43-31(35)23-20-26(38-3)29(41-6)27(21-23)39-4;;/h18-21H,7-17H2,1-6H3;2*1H |
| InChIKey | VILIWRRWAWKXRW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. cardioprotective agent Any protective agent that is able to prevent damage to the heart. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dilazep dihydrochloride (CHEBI:31493) has part dilazep(2+) (CHEBI:170000) |
| dilazep dihydrochloride (CHEBI:31493) has role cardioprotective agent (CHEBI:77307) |
| dilazep dihydrochloride (CHEBI:31493) has role platelet aggregation inhibitor (CHEBI:50427) |
| dilazep dihydrochloride (CHEBI:31493) has role vasodilator agent (CHEBI:35620) |
| dilazep dihydrochloride (CHEBI:31493) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1,4-diazepane-1,4-diyldipropane-3,1-diyl bis(3,4,5-trimethoxybenzoate) dihydrochloride |
| Synonyms | Source |
|---|---|
| 1,4-bis{3-[(3,4,5-trimethoxybenzoyl)oxy]propyl}-1,4-diazepane-1,4-diium dichloride | IUPAC |
| 1,4-bis{3-[(3,4,5-trimethoxybenzoyl)oxy]propyl}-1,4-diazepanediium dichloride | IUPAC |
| 1,4-bis[3-(3,4,5-trimethoxybenzoyloxy)propyl]homopiperazine dihydrochloride | ChEBI |
| (1,4-diazepane-1,4-diyl)di(propane-3,1-diyl) bis(3,4,5-trimethoxybenzoate)—hydrogen chloride (1/2) | IUPAC |
| AS 05 | ChemIDplus |
| ASTA C | ChemIDplus |
| Brand Names | Source |
|---|---|
| Comelian | ChEBI |
| Coratoline | ChEBI |
| Cormelian | ChemIDplus |
| Cornelian | ChEBI |
| Labitan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12954 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:20153-98-4 | ChemIDplus |
| Citations |
|---|