EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44N2O10 |
| Net Charge | 0 |
| Average Mass | 604.697 |
| Monoisotopic Mass | 604.29960 |
| SMILES | COc1cc(C(=O)OCCCN2CCCN(CCCOC(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C31H44N2O10/c1-36-24-18-22(19-25(37-2)28(24)40-5)30(34)42-16-8-12-32-10-7-11-33(15-14-32)13-9-17-43-31(35)23-20-26(38-3)29(41-6)27(21-23)39-4/h18-21H,7-17H2,1-6H3 |
| InChIKey | QVZCXCJXTMIDME-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dilazep (CHEBI:92842) has role cardioprotective agent (CHEBI:77307) |
| dilazep (CHEBI:92842) has role platelet aggregation inhibitor (CHEBI:50427) |
| dilazep (CHEBI:92842) has role vasodilator agent (CHEBI:35620) |
| dilazep (CHEBI:92842) is a benzoate ester (CHEBI:36054) |
| dilazep (CHEBI:92842) is a diazepane (CHEBI:38823) |
| dilazep (CHEBI:92842) is a diester (CHEBI:51307) |
| dilazep (CHEBI:92842) is a methoxybenzenes (CHEBI:51683) |
| dilazep (CHEBI:92842) is conjugate base of dilazep(2+) (CHEBI:170000) |
| Incoming Relation(s) |
| dilazep(2+) (CHEBI:170000) is conjugate acid of dilazep (CHEBI:92842) |
| IUPAC Name |
|---|
| 1,4-diazepane-1,4-diyldipropane-3,1-diyl bis(3,4,5-trimethoxybenzoate) |
| INNs | Source |
|---|---|
| dilazep | WHO MedNet |
| dilazep | WHO MedNet |
| dilazep | WHO MedNet |
| dilazepum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N,N'-bis[3-(3,4,5-trimethoxybenzoyloxy)propyl]homopiperazine | ChEBI |
| tetrahydro-1H-1,4-diazepine-1,4(5H)-dipropanediyl-3,4,5-trimethoxybenzoate | ChEBI |
| Citations |
|---|