EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
| InChIKey | SGEWCQFRYRRZDC-VPRICQMDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitexin (CHEBI:16954) has functional parent apigenin (CHEBI:18388) |
| vitexin (CHEBI:16954) has role antineoplastic agent (CHEBI:35610) |
| vitexin (CHEBI:16954) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| vitexin (CHEBI:16954) has role plant metabolite (CHEBI:76924) |
| vitexin (CHEBI:16954) has role platelet aggregation inhibitor (CHEBI:50427) |
| vitexin (CHEBI:16954) is a C-glycosyl compound (CHEBI:20857) |
| vitexin (CHEBI:16954) is a trihydroxyflavone (CHEBI:27116) |
| vitexin (CHEBI:16954) is conjugate acid of vitexin-7-olate (CHEBI:57963) |
| Incoming Relation(s) |
| 7-O-methylvitexin 2''-O-α-L-rhamnoside (CHEBI:31143) has functional parent vitexin (CHEBI:16954) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) has functional parent vitexin (CHEBI:16954) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) has functional parent vitexin (CHEBI:16954) |
| vitexin 2''-O-β-D-glucoside (CHEBI:16631) has functional parent vitexin (CHEBI:16954) |
| vitexin 2''-O-β-L-rhamnoside (CHEBI:82682) has functional parent vitexin (CHEBI:16954) |
| vitexin-7-olate (CHEBI:57963) is conjugate base of vitexin (CHEBI:16954) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| Apigenin 8-C-glucoside | KEGG COMPOUND |
| apigenin 8-C-glucoside | IUBMB |
| Vitexin | KEGG COMPOUND |
| Citations |
|---|