EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O14 |
| Net Charge | 0 |
| Average Mass | 592.550 |
| Monoisotopic Mass | 592.17921 |
| SMILES | COc1cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc2c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H32O14/c1-10-20(33)22(35)24(37)28(39-10)42-27-23(36)21(34)17(9-29)41-26(27)19-16(38-2)8-14(32)18-13(31)7-15(40-25(18)19)11-3-5-12(30)6-4-11/h3-8,10,17,20-24,26-30,32-37H,9H2,1-2H3/t10-,17+,20-,21+,22+,23-,24+,26-,27+,28+/m0/s1 |
| InChIKey | HFUYHHROXLKXRR-FKTIEMRLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Avena sativa (ncbitaxon:4498) | - | PubMed (6705789) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) has functional parent vitexin (CHEBI:16954) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) has role plant metabolite (CHEBI:76924) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) is a C-glycosyl compound (CHEBI:20857) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) is a dihydroxyflavone (CHEBI:38686) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) is a disaccharide derivative (CHEBI:63353) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) is a monomethoxyflavone (CHEBI:25401) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) is conjugate acid of 7-O-methylvitexin 2''-O-β-L-rhamnoside(1−) (CHEBI:78640) |
| Incoming Relation(s) |
| 7-O-methylvitexin 2''-O-β-L-rhamnoside(1−) (CHEBI:78640) is conjugate base of 7-O-methylvitexin 2''-O-β-L-rhamnoside (CHEBI:82684) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-(β-L-rhamnopyranosyl)-1-[5,7-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-chromen-8-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| (1S)-1,5-anhydro-2-O-(6-deoxy-β-L-mannopyranosyl)-1-[5,7-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-chromen-8-yl]-D-glucitol | IUPAC |
| 2''-α-rhamnopyranosyl-7-O-methylvitexin | ChEBI |
| isoswertisin 2''-O-β-L-rhamnoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 7-O-METHYLVITEXIN-2-O-B-L-RHAMNOSIDE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20848896 | Reaxys |
| Citations |
|---|