EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O14 |
| Net Charge | 0 |
| Average Mass | 578.523 |
| Monoisotopic Mass | 578.16356 |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]2c2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O14/c1-9-19(33)21(35)23(37)27(38-9)41-26-22(36)20(34)16(8-28)40-25(26)18-13(31)6-12(30)17-14(32)7-15(39-24(17)18)10-2-4-11(29)5-3-10/h2-7,9,16,19-23,25-31,33-37H,8H2,1H3/t9-,16+,19-,20+,21+,22-,23+,25-,26+,27-/m0/s1 |
| InChIKey | LYGPBZVKGHHTIE-HUBYJIGHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) has functional parent vitexin (CHEBI:16954) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) has role plant metabolite (CHEBI:76924) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) is a C-glycosyl compound (CHEBI:20857) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) is a disaccharide derivative (CHEBI:63353) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) is a trihydroxyflavone (CHEBI:27116) |
| vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) is conjugate acid of vitexin 2''-O-α-L-rhamnoside(1−) (CHEBI:60013) |
| Incoming Relation(s) |
| vitexin 2''-O-α-L-rhamnoside(1−) (CHEBI:60013) is conjugate base of vitexin 2''-O-α-L-rhamnoside (CHEBI:32298) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-2-O-(α-L-rhamnopyranosyl)-1-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol |
| Synonyms | Source |
|---|---|
| (1S)-1,5-anhydro-2-O-(6-deoxy-α-L-mannopyranosyl)-1-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]-D-glucitol | IUPAC |
| 2-O-Rhamnosylvitexin | ChEBI |
| 2''-O-Rhamnosylvitexin | KEGG COMPOUND |
| Apigenin-8-C-glucoside-2'-rhamnoside | ChemIDplus |
| Vitexin 2''-rhamnoside | KEGG COMPOUND |
| Vitexin-2''-rhamnoside | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6885855 | Reaxys |
| CAS:64820-99-1 | KEGG COMPOUND |
| CAS:64820-99-1 | ChemIDplus |
| Citations |
|---|