EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N7O14P2 |
| Net Charge | 0 |
| Average Mass | 665.446 |
| Monoisotopic Mass | 665.12477 |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C=CC1 |
| InChI | InChI=1S/C21H29N7O14P2/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(32)14(30)11(41-21)6-39-44(36,37)42-43(34,35)38-5-10-13(29)15(31)20(40-10)27-3-1-2-9(4-27)18(23)33/h1,3-4,7-8,10-11,13-16,20-21,29-32H,2,5-6H2,(H2,23,33)(H,34,35)(H,36,37)(H2,22,24,25)/t10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | BOPGDPNILDQYTO-NNYOXOHSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). fundamental metabolite Any metabolite produced by all living cells. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NADH (CHEBI:16908) has role cofactor (CHEBI:23357) |
| NADH (CHEBI:16908) has role fundamental metabolite (CHEBI:78675) |
| NADH (CHEBI:16908) is a NAD (CHEBI:13389) |
| NADH (CHEBI:16908) is a NAD(P)H (CHEBI:13392) |
| NADH (CHEBI:16908) is conjugate acid of NADH(2−) (CHEBI:57945) |
| Incoming Relation(s) |
| (S)-NADHX (CHEBI:44236) has functional parent NADH (CHEBI:16908) |
| (4S)-4-(2-propylisonicotinoyl)nicotinamide adenine dinucleotide (CHEBI:44608) has functional parent NADH (CHEBI:16908) |
| (R)-NADHX (CHEBI:134125) has functional parent NADH (CHEBI:16908) |
| AcNADH (CHEBI:74521) has functional parent NADH (CHEBI:16908) |
| NADH(2−) (CHEBI:57945) is conjugate base of NADH (CHEBI:16908) |
| IUPAC Name |
|---|
| adenosine 5'-{3-[1-(3-carbamoyl-1,4-dihydropyridin-1-yl)-1,4-anhydro-D-ribitol-5-yl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| NADH | KEGG COMPOUND |
| DPNH | KEGG COMPOUND |
| nicotinamide adenine dinucleotide (reduced) | ChEBI |
| 1,4-DIHYDRONICOTINAMIDE ADENINE DINUCLEOTIDE | PDBeChem |
| Reduced nicotinamide adenine dinucleotide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00004 | KEGG COMPOUND |
| NAI | PDBeChem |
| DB00157 | DrugBank |
| HMDB0001487 | HMDB |
| C00019343 | KNApSAcK |
| Nicotinamide_adenine_dinucleotide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:79324 | Beilstein |
| Gmelin:544241 | Gmelin |
| Reaxys:79324 | Reaxys |
| CAS:58-68-4 | ChemIDplus |
| CAS:58-68-4 | KEGG COMPOUND |
| Citations |
|---|