EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N6O14P2 |
| Net Charge | 0 |
| Average Mass | 664.458 |
| Monoisotopic Mass | 664.12952 |
| SMILES | CC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCC3OC(n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)C=CC1 |
| InChI | InChI=1S/C22H30N6O14P2/c1-10(29)11-3-2-4-27(5-11)21-17(32)15(30)12(40-21)6-38-43(34,35)42-44(36,37)39-7-13-16(31)18(33)22(41-13)28-9-26-14-19(23)24-8-25-20(14)28/h2,4-5,8-9,12-13,15-18,21-22,30-33H,3,6-7H2,1H3,(H,34,35)(H,36,37)(H2,23,24,25)/t12-,13?,15-,16-,17-,18-,21-,22?/m1/s1 |
| InChIKey | CIWXCGUGRDQCHH-CXMVDIQUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AcNADH (CHEBI:74521) has functional parent NADH (CHEBI:16908) |
| AcNADH (CHEBI:74521) has role metabolite (CHEBI:25212) |
| AcNADH (CHEBI:74521) is a dinucleotide (CHEBI:47885) |
| Synonym | Source |
|---|---|
| reduced 3-acetylpyridine adenine dinucleotide | ChEBI |