EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31N7O15P2 |
| Net Charge | 0 |
| Average Mass | 683.461 |
| Monoisotopic Mass | 683.13534 |
| SMILES | NC(=O)C1=CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)[C@H](O)CC1 |
| InChI | InChI=1S/C21H31N7O15P2/c22-17-12-19(25-6-24-17)28(7-26-12)21-16(33)14(31)10(42-21)5-40-45(37,38)43-44(35,36)39-4-9-13(30)15(32)20(41-9)27-3-8(18(23)34)1-2-11(27)29/h3,6-7,9-11,13-16,20-21,29-33H,1-2,4-5H2,(H2,23,34)(H,35,36)(H,37,38)(H2,22,24,25)/t9-,10-,11-,13-,14-,15-,16-,20-,21-/m1/s1 |
| InChIKey | IDBZKGQRLBFUFQ-MTKBYBFRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-NADHX (CHEBI:134125) has functional parent NADH (CHEBI:16908) |
| (R)-NADHX (CHEBI:134125) is a hemiaminal (CHEBI:73080) |
| (R)-NADHX (CHEBI:134125) is a tetrahydronicotinamide adenine dinucleotide (CHEBI:26916) |
| (R)-NADHX (CHEBI:134125) is conjugate acid of (R)-NADHX(2−) (CHEBI:64075) |
| Incoming Relation(s) |
| (R)-NADHX(2−) (CHEBI:64075) is conjugate base of (R)-NADHX (CHEBI:134125) |
| IUPAC Name |
|---|
| adenosine 5'-(3-{5-[(2R)-5-carbamoyl-2-hydroxy-3,4-dihydropyridin-1-yl]-5-deoxy-β-D-ribofuranosyl} dihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| (6R)-6-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide | ChEBI |
| (6R)-6β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide | KEGG COMPOUND |
| (R)-NADH-hydrate | KEGG COMPOUND |
| Citations |
|---|