EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11O3 |
| Net Charge | -1 |
| Average Mass | 143.162 |
| Monoisotopic Mass | 143.07137 |
| SMILES | O=C([O-])[C@H]1CC[C@H](O)CC1 |
| InChI | InChI=1S/C7H12O3/c8-6-3-1-5(2-4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/p-1/t5-,6- |
| InChIKey | HCFRWBBJISAZNK-IZLXSQMJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-4-hydroxycyclohexanecarboxylate (CHEBI:57906) is a 4-hydroxycyclohexanecarboxylate (CHEBI:747087) |
| trans-4-hydroxycyclohexanecarboxylate (CHEBI:57906) is conjugate base of trans-4-hydroxycyclohexanecarboxylic acid (CHEBI:16817) |
| Incoming Relation(s) |
| trans-4-hydroxycyclohexanecarboxylic acid (CHEBI:16817) is conjugate acid of trans-4-hydroxycyclohexanecarboxylate (CHEBI:57906) |
| IUPAC Name |
|---|
| trans-4-hydroxycyclohexanecarboxylate |
| Synonym | Source |
|---|---|
| trans-4-hydroxycyclohexanecarboxylate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| trans-4-hydroxycyclohexane-1-carboxylate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11063764 | Beilstein |