EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H5N2O2S2 |
| Net Charge | -1 |
| Average Mass | 249.296 |
| Monoisotopic Mass | 248.97979 |
| SMILES | O=c1[c-]sc(-c2nc3ccc(O)cc3s2)n1 |
| InChI | InChI=1S/C10H5N2O2S2/c13-5-1-2-6-7(3-5)16-10(11-6)9-12-8(14)4-15-9/h1-4,13H/q-1 |
| InChIKey | STZAIUOSQGEONE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxidized Photinus luciferin(1−) (CHEBI:57900) is a organic anion (CHEBI:25696) |
| oxidized Photinus luciferin(1−) (CHEBI:57900) is conjugate base of oxidized Photinus luciferin (CHEBI:16792) |
| Incoming Relation(s) |
| oxidized Photinus luciferin (CHEBI:16792) is conjugate acid of oxidized Photinus luciferin(1−) (CHEBI:57900) |
| IUPAC Name |
|---|
| 2-(6-hydroxy-1,3-benzothiazol-2-yl)-4-oxo-4,5-dihydro-1,3-thiazol-5-ide |
| Synonyms | Source |
|---|---|
| oxidised Photinus luciferin(1−) | ChEBI |
| oxidised Photinus luciferin anion | ChEBI |
| oxidized Photinus luciferin anion | ChEBI |