EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16FN2O2 |
| Net Charge | +1 |
| Average Mass | 299.325 |
| Monoisotopic Mass | 299.11903 |
| SMILES | C[NH2+]Cc1ccc(-c2cc3cc(F)cc(C(N)=O)c3o2)cc1 |
| InChI | InChI=1S/C17H15FN2O2/c1-20-9-10-2-4-11(5-3-10)15-7-12-6-13(18)8-14(17(19)21)16(12)22-15/h2-8,20H,9H2,1H3,(H2,19,21)/p+1 |
| InChIKey | ROBJKLPZIPNAMV-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mefuparib(1+) (CHEBI:167906) is a secondary ammonium ion (CHEBI:137419) |
| mefuparib(1+) (CHEBI:167906) is conjugate acid of mefuparib (CHEBI:167905) |
| Incoming Relation(s) |
| mefuparib hydrochloride (CHEBI:167899) has part mefuparib(1+) (CHEBI:167906) |
| mefuparib (CHEBI:167905) is conjugate base of mefuparib(1+) (CHEBI:167906) |
| IUPAC Name |
|---|
| [4-(7-carbamoyl-5-fluoro-1-benzofuran-2-yl)phenyl]-N-methylmethanaminium |
| Synonym | Source |
|---|---|
| mefuparib cation | ChEBI |