EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15FN2O2 |
| Net Charge | 0 |
| Average Mass | 298.317 |
| Monoisotopic Mass | 298.11176 |
| SMILES | CNCc1ccc(-c2cc3cc(F)cc(C(N)=O)c3o2)cc1 |
| InChI | InChI=1S/C17H15FN2O2/c1-20-9-10-2-4-11(5-3-10)15-7-12-6-13(18)8-14(17(19)21)16(12)22-15/h2-8,20H,9H2,1H3,(H2,19,21) |
| InChIKey | ROBJKLPZIPNAMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mefuparib (CHEBI:167905) has role anticoronaviral agent (CHEBI:149553) |
| mefuparib (CHEBI:167905) has role antineoplastic agent (CHEBI:35610) |
| mefuparib (CHEBI:167905) has role apoptosis inducer (CHEBI:68495) |
| mefuparib (CHEBI:167905) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| mefuparib (CHEBI:167905) is a 1-benzofurans (CHEBI:38830) |
| mefuparib (CHEBI:167905) is a organofluorine compound (CHEBI:37143) |
| mefuparib (CHEBI:167905) is a primary carboxamide (CHEBI:140324) |
| mefuparib (CHEBI:167905) is a secondary amino compound (CHEBI:50995) |
| mefuparib (CHEBI:167905) is conjugate base of mefuparib(1+) (CHEBI:167906) |
| Incoming Relation(s) |
| mefuparib(1+) (CHEBI:167906) is conjugate acid of mefuparib (CHEBI:167905) |
| IUPAC Name |
|---|
| 5-fluoro-2-{4-[(methylamino)methyl]phenyl}-1-benzofuran-7-carboxamide |
| Synonym | Source |
|---|---|
| CVL-218 free base | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5378 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1392502-82-7 | ChemIDplus |
| Citations |
|---|