EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15FN2O2.HCl |
| Net Charge | 0 |
| Average Mass | 334.778 |
| Monoisotopic Mass | 334.08843 |
| SMILES | CNCc1ccc(-c2cc3cc(F)cc(C(N)=O)c3o2)cc1.Cl |
| InChI | InChI=1S/C17H15FN2O2.ClH/c1-20-9-10-2-4-11(5-3-10)15-7-12-6-13(18)8-14(17(19)21)16(12)22-15;/h2-8,20H,9H2,1H3,(H2,19,21);1H |
| InChIKey | GPFWTAVHQKERKY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.4.2.30 (NAD(+) ADP-ribosyltransferase) inhibitor An EC 2.4.2.* (pentosyltransferase) inhibitor that interferes with the action of a NAD+ ADP-ribosyltransferase (EC 2.4.2.30). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mefuparib hydrochloride (CHEBI:167899) has part mefuparib(1+) (CHEBI:167906) |
| mefuparib hydrochloride (CHEBI:167899) has role anticoronaviral agent (CHEBI:149553) |
| mefuparib hydrochloride (CHEBI:167899) has role antineoplastic agent (CHEBI:35610) |
| mefuparib hydrochloride (CHEBI:167899) has role apoptosis inducer (CHEBI:68495) |
| mefuparib hydrochloride (CHEBI:167899) has role EC 2.4.2.30 (NAD+ ADP-ribosyltransferase) inhibitor (CHEBI:62913) |
| mefuparib hydrochloride (CHEBI:167899) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 5-fluoro-2-{4-[(methylamino)methyl]phenyl}-1-benzofuran-7-carboxamide hydrochloride |
| Synonyms | Source |
|---|---|
| [4-(7-carbamoyl-5-fluoro-1-benzofuran-2-yl)phenyl]-N-methylmethanaminium chloride | IUPAC |
| 5-fluoro-2-{4-[(methylamino)methyl]phenyl}-1-benzofuran-7-carboxamide—hydrogen chloride | IUPAC |
| 5-fluoro-2-(4-((methylamino)methyl)phenyl)benzofuran-7-carboxamide hydrochloride | ChEBI |
| CVL 218 | ChEBI |
| CVL-218 | ChEBI |
| CVL218 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1449746-00-2 | ChemIDplus |
| Citations |
|---|