EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14FN2O3S |
| Net Charge | +1 |
| Average Mass | 249.287 |
| Monoisotopic Mass | 249.07037 |
| SMILES | CS(=O)(=O)Nc1ccc(F)c([C@@H](O)C[NH3+])c1 |
| InChI | InChI=1S/C9H13FN2O3S/c1-16(14,15)12-6-2-3-8(10)7(4-6)9(13)5-11/h2-4,9,12-13H,5,11H2,1H3/p+1/t9-/m0/s1 |
| InChIKey | XYLJNMCMDOOJRW-VIFPVBQESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garomefrine(1+) (CHEBI:167679) is a primary ammonium ion (CHEBI:65296) |
| garomefrine(1+) (CHEBI:167679) is conjugate acid of garomefrine (CHEBI:167667) |
| Incoming Relation(s) |
| garomefrine hydrochloride (CHEBI:167680) has part garomefrine(1+) (CHEBI:167679) |
| garomefrine (CHEBI:167667) is conjugate base of garomefrine(1+) (CHEBI:167679) |
| IUPAC Name |
|---|
| (2R)-2-{2-fluoro-5-[(methylsulfonyl)amino]phenyl}-2-hydroxyethanaminium |
| Synonym | Source |
|---|---|
| garomefrine cation | ChEBI |