EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13FN2O3S.HCl |
| Net Charge | 0 |
| Average Mass | 284.740 |
| Monoisotopic Mass | 284.03977 |
| SMILES | CS(=O)(=O)Nc1ccc(F)c([C@@H](O)CN)c1.Cl |
| InChI | InChI=1S/C9H13FN2O3S.ClH/c1-16(14,15)12-6-2-3-8(10)7(4-6)9(13)5-11;/h2-4,9,12-13H,5,11H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | NYBZUGIMUSJVGU-FVGYRXGTSA-N |
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garomefrine hydrochloride (CHEBI:167680) has part garomefrine(1+) (CHEBI:167679) |
| garomefrine hydrochloride (CHEBI:167680) has role nasal decongestant (CHEBI:77715) |
| garomefrine hydrochloride (CHEBI:167680) has role α-adrenergic agonist (CHEBI:35569) |
| garomefrine hydrochloride (CHEBI:167680) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N-{3-[(1R)-2-amino-1-hydroxyethyl]-4-fluorophenyl}methanesulfonamide hydrochloride |
| Synonyms | Source |
|---|---|
| (2R)-2-{2-fluoro-5-[(methylsulfonyl)amino]phenyl}-2-hydroxyethanaminium chloride | IUPAC |
| PNO-49B | ChemIDplus |
| (−)-garomefrine hydrochloride | ChemIDplus |
| ABT-232 | ChemIDplus |
| garomefrine monohydrochloride | ChemIDplus |
| garomefrin hydrochloride | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:137431-04-0 | ChemIDplus |
| Citations |
|---|