EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13FN2O3S |
| Net Charge | 0 |
| Average Mass | 248.279 |
| Monoisotopic Mass | 248.06309 |
| SMILES | CS(=O)(=O)Nc1ccc(F)c([C@@H](O)CN)c1 |
| InChI | InChI=1S/C9H13FN2O3S/c1-16(14,15)12-6-2-3-8(10)7(4-6)9(13)5-11/h2-4,9,12-13H,5,11H2,1H3/t9-/m0/s1 |
| InChIKey | XYLJNMCMDOOJRW-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Application: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| garomefrine (CHEBI:167667) has role α-adrenergic agonist (CHEBI:35569) |
| garomefrine (CHEBI:167667) is a ethanolamines (CHEBI:23981) |
| garomefrine (CHEBI:167667) is a monofluorobenzenes (CHEBI:83575) |
| garomefrine (CHEBI:167667) is a primary amino compound (CHEBI:50994) |
| garomefrine (CHEBI:167667) is a secondary alcohol (CHEBI:35681) |
| garomefrine (CHEBI:167667) is a sulfonamide (CHEBI:35358) |
| garomefrine (CHEBI:167667) is conjugate base of garomefrine(1+) (CHEBI:167679) |
| Incoming Relation(s) |
| garomefrine(1+) (CHEBI:167679) is conjugate acid of garomefrine (CHEBI:167667) |
| IUPAC Name |
|---|
| N-{3-[(1R)-2-amino-1-hydroxyethyl]-4-fluorophenyl}methanesulfonamide |
| Synonyms | Source |
|---|---|
| (−)-garomefrin | ChemIDplus |
| NS-49 (free base) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8014483 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:137431-02-8 | ChemIDplus |
| Citations |
|---|