EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O2 |
| Net Charge | 0 |
| Average Mass | 210.232 |
| Monoisotopic Mass | 210.06808 |
| SMILES | Oc1ccc2ccc3ccccc3c2c1O |
| InChI | InChI=1S/C14H10O2/c15-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)14(12)16/h1-8,15-16H |
| InChIKey | RLZZZVKAURTHCP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenanthrene-3,4-diol (CHEBI:16760) has role mouse metabolite (CHEBI:75771) |
| phenanthrene-3,4-diol (CHEBI:16760) is a phenanthrenediol (CHEBI:37453) |
| Incoming Relation(s) |
| 3,4-dihydrophenanthrene-3,4-diol (CHEBI:37464) has functional parent phenanthrene-3,4-diol (CHEBI:16760) |
| 3,4-phenanthrenediyl bissulfate (CHEBI:25953) has functional parent phenanthrene-3,4-diol (CHEBI:16760) |
| IUPAC Name |
|---|
| phenanthrene-3,4-diol |
| Synonyms | Source |
|---|---|
| Phenanthrene-3,4-diol | KEGG COMPOUND |
| 3,4-Dihydroxyphenanthrene | KEGG COMPOUND |
| 3,4-phenanthrenediol | ChemIDplus |
| Morphol | ChemIDplus |
| 3,4-dihydroxyphenanthrene | UM-BBD |
| UniProt Name | Source |
|---|---|
| phenanthrene-3,4-diol | UniProt |