EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | OC1C=Cc2ccc3ccccc3c2C1O |
| InChI | InChI=1S/C14H12O2/c15-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)14(12)16/h1-8,12,14-16H |
| InChIKey | FOTICWSJABVKPW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydrophenanthrene-3,4-diol (CHEBI:37464) has functional parent phenanthrene-3,4-diol (CHEBI:16760) |
| 3,4-dihydrophenanthrene-3,4-diol (CHEBI:37464) is a dihydrophenanthrenediol (CHEBI:23738) |
| Incoming Relation(s) |
| cis-3,4-dihydrophenanthrene-3,4-diol (CHEBI:23286) is a 3,4-dihydrophenanthrene-3,4-diol (CHEBI:37464) |
| trans-3,4-dihydrophenanthrene-3,4-diol (CHEBI:27051) is a 3,4-dihydrophenanthrene-3,4-diol (CHEBI:37464) |
| IUPAC Name |
|---|
| 3,4-dihydrophenanthrene-3,4-diol |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-3,4-phenanthrenediol | ChemIDplus |
| 3,4-dihydromorphol | ChemIDplus |
| phenanthrene-3,4-dihydrodiol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:20057-09-4 | ChemIDplus |