EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8O8S2 |
| Net Charge | -2 |
| Average Mass | 368.344 |
| Monoisotopic Mass | 367.96716 |
| SMILES | O=S(=O)([O-])Oc1ccc2ccc3ccccc3c2c1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C14H10O8S2/c15-23(16,17)21-12-8-7-10-6-5-9-3-1-2-4-11(9)13(10)14(12)22-24(18,19)20/h1-8H,(H,15,16,17)(H,18,19,20)/p-2 |
| InChIKey | GSZDNVOCMMHYTL-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-phenanthrenediyl bissulfate (CHEBI:25953) has functional parent phenanthrene-3,4-diol (CHEBI:16760) |
| 3,4-phenanthrenediyl bissulfate (CHEBI:25953) is a phenanthrenediyl bissulfate (CHEBI:25958) |
| IUPAC Name |
|---|
| phenanthrene-3,4-diyl bissulfate |
| Synonyms | Source |
|---|---|
| 3,4-phenanthryl-disulfate | UM-BBD |
| phenanthrene-3,4-dihydrodiolsulfate conjugate | UM-BBD |
| Manual Xrefs | Databases |
|---|---|
| c0528 | UM-BBD |