EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO |
| Net Charge | 0 |
| Average Mass | 309.453 |
| Monoisotopic Mass | 309.20926 |
| SMILES | CCC(=O)C(C[C@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3/t17-/m0/s1 |
| InChIKey | USSIQXCVUWKGNF-KRWDZBQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextromethadone (CHEBI:167308) has role NMDA receptor antagonist (CHEBI:60643) |
| dextromethadone (CHEBI:167308) has role opioid analgesic (CHEBI:35482) |
| dextromethadone (CHEBI:167308) is a 6-(dimethylamino)-4,4-diphenylheptan-3-one (CHEBI:167309) |
| dextromethadone (CHEBI:167308) is enantiomer of levomethadone (CHEBI:136003) |
| Incoming Relation(s) |
| methadone (CHEBI:6807) has part dextromethadone (CHEBI:167308) |
| levomethadone (CHEBI:136003) is enantiomer of dextromethadone (CHEBI:167308) |
| IUPAC Name |
|---|
| (6S)-6-(dimethylamino)-4,4-diphenylheptan-3-one |
| Synonyms | Source |
|---|---|
| (6S)-methadone | ChemIDplus |
| d-6-(dimethylamino)-4,4-diphenyl-3-heptanone | ChemIDplus |
| d-methadone | ChemIDplus |
| (+)-(S)-6-(dimethylamino)-4,4-diphenyl-3-heptanone | ChEBI |
| (S)-6-(dimethylamino)-4,4-diphenyl-3-heptanone | ChemIDplus |
| (S)-(+)-methadone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 559067 | ChemSpider |
| DB15198 | DrugBank |
| Dextromethadone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3213667 | Reaxys |
| CAS:5653-80-5 | ChemIDplus |
| Citations |
|---|