EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO |
| Net Charge | 0 |
| Average Mass | 309.453 |
| Monoisotopic Mass | 309.20926 |
| SMILES | CCC(=O)C(C[C@@H](C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3/t17-/m1/s1 |
| InChIKey | USSIQXCVUWKGNF-QGZVFWFLSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levomethadone (CHEBI:136003) has role antitussive (CHEBI:51177) |
| levomethadone (CHEBI:136003) has role NMDA receptor antagonist (CHEBI:60643) |
| levomethadone (CHEBI:136003) has role opioid analgesic (CHEBI:35482) |
| levomethadone (CHEBI:136003) has role μ-opioid receptor agonist (CHEBI:55322) |
| levomethadone (CHEBI:136003) is a 6-(dimethylamino)-4,4-diphenylheptan-3-one (CHEBI:167309) |
| levomethadone (CHEBI:136003) is enantiomer of dextromethadone (CHEBI:167308) |
| Incoming Relation(s) |
| methadone (CHEBI:6807) has part levomethadone (CHEBI:136003) |
| dextromethadone (CHEBI:167308) is enantiomer of levomethadone (CHEBI:136003) |
| IUPAC Name |
|---|
| (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one |
| INNs | Source |
|---|---|
| levometadona | WHO MedNet |
| levomethadone | WHO MedNet |
| lévométhadone | WHO MedNet |
| levomethadonum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (6R)-methadone | ChemIDplus |
| l-methadone | ChemIDplus |
| (R)-6-(dimethylamino)-4,4-diphenyl-3-heptanone | ChemIDplus |
| (−)-(R)-6-(dimethylamino)-4,4-diphenyl-3-heptanone | ChemIDplus |
| (R)-(−)-methadone | ChEBI |
| (R)-methadone | ChEBI |
| Citations |
|---|