EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H7O4S |
| Net Charge | -1 |
| Average Mass | 223.229 |
| Monoisotopic Mass | 223.00705 |
| SMILES | O=S(=O)([O-])Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O4S/c11-15(12,13)14-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,11,12,13)/p-1 |
| InChIKey | HXEZIDSFDHEIIQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-naphthyl sulfate(1−) (CHEBI:167170) is a aryl sulfate oxoanion (CHEBI:139371) |
| 2-naphthyl sulfate(1−) (CHEBI:167170) is conjugate base of 2-naphthyl sulfate (CHEBI:167215) |
| Incoming Relation(s) |
| 2-naphthyl sulfate (CHEBI:167215) is conjugate acid of 2-naphthyl sulfate(1−) (CHEBI:167170) |
| IUPAC Name |
|---|
| naphthalen-2-yl sulfate |
| UniProt Name | Source |
|---|---|
| 2-naphthyl sulfate | UniProt |
| Citations |
|---|