EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7O3 |
| Net Charge | -1 |
| Average Mass | 151.141 |
| Monoisotopic Mass | 151.04007 |
| SMILES | COc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/p-1 |
| InChIKey | ZEYHEAKUIGZSGI-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxybenzoate (CHEBI:16639) has functional parent benzoate (CHEBI:16150) |
| 4-methoxybenzoate (CHEBI:16639) has role plant metabolite (CHEBI:76924) |
| 4-methoxybenzoate (CHEBI:16639) is a methoxybenzoate (CHEBI:25236) |
| 4-methoxybenzoate (CHEBI:16639) is conjugate base of 4-methoxybenzoic acid (CHEBI:40813) |
| Incoming Relation(s) |
| 3-amino-2-hydroxy-4-methoxybenzoate (CHEBI:180662) is a 4-methoxybenzoate (CHEBI:16639) |
| 4-methoxybenzoic acid (CHEBI:40813) is conjugate acid of 4-methoxybenzoate (CHEBI:16639) |
| IUPAC Name |
|---|
| 4-methoxybenzoate |
| Synonym | Source |
|---|---|
| p-methoxybenzoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-methoxybenzoate | UniProt |