EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8NO4 |
| Net Charge | -1 |
| Average Mass | 182.155 |
| Monoisotopic Mass | 182.04588 |
| SMILES | COc1ccc(C(=O)[O-])c(O)c1N |
| InChI | InChI=1S/C8H9NO4/c1-13-5-3-2-4(8(11)12)7(10)6(5)9/h2-3,10H,9H2,1H3,(H,11,12)/p-1 |
| InChIKey | GLNDMRAULQPRMT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-amino-2-hydroxy-4-methoxybenzoate (CHEBI:180662) is a 4-methoxybenzoate (CHEBI:16639) |
| UniProt Name | Source |
|---|---|
| 3-amino-2-hydroxy-4-methoxybenzoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-23564 | MetaCyc |
| Citations |
|---|